C8H15NO2 — CID 163911940
[(2S)-6-methoxy-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]methanol (PubChem CID 163911940) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is [(2S)-6-methoxy-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]methanol.
| Compound Name | [(2S)-6-methoxy-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]methanol |
|---|---|
| PubChem CID | 163911940 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(2S)-6-methoxy-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]methanol |
| SMILES | COC1C=C(C)C[C@@H](CO)N1 |
| InChI | InChI=1S/C8H15NO2/c1-6-3-7(5-10)9-8(4-6)11-2/h4,7-10H,3,5H2,1-2H3/t7-,8?/m0/s1 |
| InChIKey | QSWBRFDIKSJRTK-JAMMHHFISA-N |
| XLogP | 0.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|