C15H15ClN2O2 — CID 103926145
6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-methylpyridin-3-amine (PubChem CID 103926145) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-methylpyridin-3-amine.
| Compound Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 103926145 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-methylpyridin-3-amine |
| SMILES | Cc1cc(NCc2ccc3c(c2)OCCO3)cnc1Cl |
| InChI | InChI=1S/C15H15ClN2O2/c1-10-6-12(9-18-15(10)16)17-8-11-2-3-13-14(7-11)20-5-4-19-13/h2-3,6-7,9,17H,4-5,8H2,1H3 |
| InChIKey | BSIDYCYPBPGPMC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|