C14H12BrClN2O — CID 103930553
5-bromo-6-chloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pyridin-3-amine (PubChem CID 103930553) has the molecular formula C14H12BrClN2O and a molecular weight of 339.62 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pyridin-3-amine.
| Compound Name | 5-bromo-6-chloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 103930553 |
| Molecular Formula | C14H12BrClN2O |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 5-bromo-6-chloro-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)pyridin-3-amine |
| SMILES | Clc1ncc(NCc2ccc3c(c2)CCO3)cc1Br |
| InChI | InChI=1S/C14H12BrClN2O/c15-12-6-11(8-18-14(12)16)17-7-9-1-2-13-10(5-9)3-4-19-13/h1-2,5-6,8,17H,3-4,7H2 |
| InChIKey | CSBIGVWTNFDGOF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|