C16H27NO4 — CID 103935740
2-[1-(3,4-dimethoxyphenyl)propylamino]-2-ethylpropane-1,3-diol (PubChem CID 103935740) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)propylamino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)propylamino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 103935740 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)propylamino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(NC(CC)(CO)CO)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H27NO4/c1-5-13(17-16(6-2,10-18)11-19)12-7-8-14(20-3)15(9-12)21-4/h7-9,13,17-19H,5-6,10-11H2,1-4H3 |
| InChIKey | MXRZVQHOKGYZSU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |