About 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione
3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione (PubChem CID 103936507) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione |
| PubChem CID | 103936507 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione |
| SMILES | CSC1CCCCC1N1C(=O)CNC1=O |
| InChI | InChI=1S/C10H16N2O2S/c1-15-8-5-3-2-4-7(8)12-9(13)6-11-10(12)14/h7-8H,2-6H2,1H3,(H,11,14) |
| InChIKey | BJYMHSJSRNLSCN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione?
The IUPAC name of 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione (CID 103936507) is 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione.
What is the SMILES notation for 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione?
The canonical SMILES for 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione is CSC1CCCCC1N1C(=O)CNC1=O.
What is the InChIKey of 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione?
The InChIKey is BJYMHSJSRNLSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-15-8-5-3-2-4-7(8)12-9(13)6-11-10(12)14/h7-8H,2-6H2,1H3,(H,11,14).
What are the key properties of 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione?
3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione has a molecular weight of 228.32 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione is sourced from PubChem (CID 103936507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).