C10H16N2O2S — CID 103936507
3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione (PubChem CID 103936507) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103936507 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-(2-methylsulfanylcyclohexyl)imidazolidine-2,4-dione |
| SMILES | CSC1CCCCC1N1C(=O)CNC1=O |
| InChI | InChI=1S/C10H16N2O2S/c1-15-8-5-3-2-4-7(8)12-9(13)6-11-10(12)14/h7-8H,2-6H2,1H3,(H,11,14) |
| InChIKey | BJYMHSJSRNLSCN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|