C9H11N3O2S — CID 103936543
3-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 103936543) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103936543 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cnc(C(C)N2C(=O)CNC2=O)s1 |
| InChI | InChI=1S/C9H11N3O2S/c1-5-3-10-8(15-5)6(2)12-7(13)4-11-9(12)14/h3,6H,4H2,1-2H3,(H,11,14) |
| InChIKey | FZTLLGIAQGZCFD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|