C14H27NO4 — CID 103940347
(3S)-5-methyl-3-[[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]methyl]hexanoic acid (PubChem CID 103940347) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is (3S)-5-methyl-3-[[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]methyl]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 103940347 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (3S)-5-methyl-3-[[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]methyl]hexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)COC(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C14H27NO4/c1-10(2)6-11(7-13(17)18)8-15-12(16)9-19-14(3,4)5/h10-11H,6-9H2,1-5H3,(H,15,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | STNMGLLVOPQHMA-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |