C14H28N2O4 — CID 104764025
(3S)-3-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]-5-methylhexanoic acid (PubChem CID 104764025) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3S)-3-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 104764025 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (3S)-3-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]-5-methylhexanoic acid |
| SMILES | COC(C)(C)CNC(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-10(2)6-11(7-12(17)18)8-15-13(19)16-9-14(3,4)20-5/h10-11H,6-9H2,1-5H3,(H,17,18)(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | KOXXFBLVQDURMI-NSHDSACASA-N |
| XLogP | 1.85 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |