C15H30N2O4 — CID 82941576
(3S)-5-methyl-3-[(3-propoxypropylcarbamoylamino)methyl]hexanoic acid (PubChem CID 82941576) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S)-5-methyl-3-[(3-propoxypropylcarbamoylamino)methyl]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[(3-propoxypropylcarbamoylamino)methyl]hexanoic acid |
|---|---|
| PubChem CID | 82941576 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3S)-5-methyl-3-[(3-propoxypropylcarbamoylamino)methyl]hexanoic acid |
| SMILES | CCCOCCCNC(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C15H30N2O4/c1-4-7-21-8-5-6-16-15(20)17-11-13(9-12(2)3)10-14(18)19/h12-13H,4-11H2,1-3H3,(H,18,19)(H2,16,17,20)/t13-/m0/s1 |
| InChIKey | FAAAVTOFRRBMHE-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|