C10H14N6O — CID 103943105
1-ethyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one (PubChem CID 103943105) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-ethyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one.
| Compound Name | 1-ethyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 103943105 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-ethyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one |
| SMILES | CCn1ccnc(NC(C)c2ncn[nH]2)c1=O |
| InChI | InChI=1S/C10H14N6O/c1-3-16-5-4-11-9(10(16)17)14-7(2)8-12-6-13-15-8/h4-7H,3H2,1-2H3,(H,11,14)(H,12,13,15) |
| InChIKey | KJRQHMMDMAWAHZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |