C8H11F2N3O — CID 115407571
3-(2,2-difluoroethylamino)-1-ethylpyrazin-2-one (PubChem CID 115407571) has the molecular formula C8H11F2N3O and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-(2,2-difluoroethylamino)-1-ethylpyrazin-2-one.
| Compound Name | 3-(2,2-difluoroethylamino)-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 115407571 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(2,2-difluoroethylamino)-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NCC(F)F)c1=O |
| InChI | InChI=1S/C8H11F2N3O/c1-2-13-4-3-11-7(8(13)14)12-5-6(9)10/h3-4,6H,2,5H2,1H3,(H,11,12) |
| InChIKey | LQHXTPKLNYTWJA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |