C11H16F3N3O — CID 113327814
1-ethyl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one (PubChem CID 113327814) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-ethyl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one.
| Compound Name | 1-ethyl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 113327814 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-ethyl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one |
| SMILES | CCn1ccnc(NCCCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H16F3N3O/c1-2-17-8-7-16-9(10(17)18)15-6-4-3-5-11(12,13)14/h7-8H,2-6H2,1H3,(H,15,16) |
| InChIKey | LRGIGSFBTLMHFZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|