C13H24N4O — CID 106142615
3-[(5-amino-2,2-dimethylpentyl)amino]-1-ethylpyrazin-2-one (PubChem CID 106142615) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-[(5-amino-2,2-dimethylpentyl)amino]-1-ethylpyrazin-2-one.
| Compound Name | 3-[(5-amino-2,2-dimethylpentyl)amino]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 106142615 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 3-[(5-amino-2,2-dimethylpentyl)amino]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NCC(C)(C)CCCN)c1=O |
| InChI | InChI=1S/C13H24N4O/c1-4-17-9-8-15-11(12(17)18)16-10-13(2,3)6-5-7-14/h8-9H,4-7,10,14H2,1-3H3,(H,15,16) |
| InChIKey | RMDMHCZUIHKFGG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |