C11H20N4O2 — CID 114171621
3-[3-(2-aminoethoxy)propylamino]-1-ethylpyrazin-2-one (PubChem CID 114171621) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[3-(2-aminoethoxy)propylamino]-1-ethylpyrazin-2-one.
| Compound Name | 3-[3-(2-aminoethoxy)propylamino]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 114171621 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-[3-(2-aminoethoxy)propylamino]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NCCCOCCN)c1=O |
| InChI | InChI=1S/C11H20N4O2/c1-2-15-7-6-14-10(11(15)16)13-5-3-8-17-9-4-12/h6-7H,2-5,8-9,12H2,1H3,(H,13,14) |
| InChIKey | RRVRITZUALMPHI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|