C8H14N4O3S — CID 62940018
2-[(4-ethyl-3-oxopyrazin-2-yl)amino]ethanesulfonamide (PubChem CID 62940018) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-[(4-ethyl-3-oxopyrazin-2-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(4-ethyl-3-oxopyrazin-2-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 62940018 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-[(4-ethyl-3-oxopyrazin-2-yl)amino]ethanesulfonamide |
| SMILES | CCn1ccnc(NCCS(N)(=O)=O)c1=O |
| InChI | InChI=1S/C8H14N4O3S/c1-2-12-5-3-10-7(8(12)13)11-4-6-16(9,14)15/h3,5H,2,4,6H2,1H3,(H,10,11)(H2,9,14,15) |
| InChIKey | LWIBNQPHBSSZKM-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |