About 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one
1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one (PubChem CID 113356058) has the molecular formula C11H14N6O
and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one |
| PubChem CID | 113356058 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one |
| SMILES | CC(Nc1nccn(C2CC2)c1=O)c1ncn[nH]1 |
| InChI | InChI=1S/C11H14N6O/c1-7(9-13-6-14-16-9)15-10-11(18)17(5-4-12-10)8-2-3-8/h4-8H,2-3H2,1H3,(H,12,15)(H,13,14,16) |
| InChIKey | GLHZNRZNEAMIKN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one?
The IUPAC name of 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one (CID 113356058) is 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one.
What is the SMILES notation for 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one?
The canonical SMILES for 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one is CC(Nc1nccn(C2CC2)c1=O)c1ncn[nH]1.
What is the InChIKey of 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one?
The InChIKey is GLHZNRZNEAMIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N6O/c1-7(9-13-6-14-16-9)15-10-11(18)17(5-4-12-10)8-2-3-8/h4-8H,2-3H2,1H3,(H,12,15)(H,13,14,16).
What are the key properties of 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one?
1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one has a molecular weight of 246.27 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrazin-2-one is sourced from PubChem (CID 113356058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).