C9H22N2O3S — CID 103946772
2-methyl-1-(propan-2-ylsulfamoylamino)pentan-2-ol (PubChem CID 103946772) has the molecular formula C9H22N2O3S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-methyl-1-(propan-2-ylsulfamoylamino)pentan-2-ol.
| Compound Name | 2-methyl-1-(propan-2-ylsulfamoylamino)pentan-2-ol |
|---|---|
| PubChem CID | 103946772 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-methyl-1-(propan-2-ylsulfamoylamino)pentan-2-ol |
| SMILES | CCCC(C)(O)CNS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C9H22N2O3S/c1-5-6-9(4,12)7-10-15(13,14)11-8(2)3/h8,10-12H,5-7H2,1-4H3 |
| InChIKey | IYLZICOPLMHYEB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |