C8H9F4NO — CID 103947495
1-(3,6-dihydro-2H-pyridin-1-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 103947495) has the molecular formula C8H9F4NO and a molecular weight of 211.16 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 103947495 |
| Molecular Formula | C8H9F4NO |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(N1CC=CCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H9F4NO/c9-6(10)8(11,12)7(14)13-4-2-1-3-5-13/h1-2,6H,3-5H2 |
| InChIKey | QVSLIKAGCZLFRK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|