C14H23FN2O2 — CID 103948352
1-[1-(5-fluoro-2-pyridinyl)propylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 103948352) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-pyridinyl)propylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[1-(5-fluoro-2-pyridinyl)propylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 103948352 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-[1-(5-fluoro-2-pyridinyl)propylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | CCC(NCC(C)(O)CCOC)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H23FN2O2/c1-4-12(13-6-5-11(15)9-16-13)17-10-14(2,18)7-8-19-3/h5-6,9,12,17-18H,4,7-8,10H2,1-3H3 |
| InChIKey | DOGGUISEBGANSL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |