C13H23NO — CID 103952213
3-[2-(cyclopenten-1-yl)ethylamino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 103952213) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-[2-(cyclopenten-1-yl)ethylamino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[2-(cyclopenten-1-yl)ethylamino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103952213 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-[2-(cyclopenten-1-yl)ethylamino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCCC1=CCCC1 |
| InChI | InChI=1S/C13H23NO/c1-13(2)11(9-12(13)15)14-8-7-10-5-3-4-6-10/h5,11-12,14-15H,3-4,6-9H2,1-2H3 |
| InChIKey | ZOTIOKSUHXTTLH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|