C16H29NO — CID 39819326
[1-[[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclobutyl]methanol (PubChem CID 39819326) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is [1-[[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclobutyl]methanol.
| Compound Name | [1-[[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 39819326 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | [1-[[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]methyl]cyclobutyl]methanol |
| SMILES | CC(C)=CCC/C(C)=C/CNCC1(CO)CCC1 |
| InChI | InChI=1S/C16H29NO/c1-14(2)6-4-7-15(3)8-11-17-12-16(13-18)9-5-10-16/h6,8,17-18H,4-5,7,9-13H2,1-3H3/b15-8+ |
| InChIKey | LPUIDAKJDPPQHY-OVCLIPMQSA-N |
| XLogP | 3.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|