C12H21NO — CID 103952193
3-(cyclohex-2-en-1-ylamino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 103952193) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-(cyclohex-2-en-1-ylamino)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(cyclohex-2-en-1-ylamino)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103952193 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3-(cyclohex-2-en-1-ylamino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NC1C=CCCC1 |
| InChI | InChI=1S/C12H21NO/c1-12(2)10(8-11(12)14)13-9-6-4-3-5-7-9/h4,6,9-11,13-14H,3,5,7-8H2,1-2H3 |
| InChIKey | MSBWYDOVJUWJBZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|