C18H25N3 — CID 103967080
N-(3,3,5,5-tetramethylcyclohexyl)phthalazin-1-amine (PubChem CID 103967080) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-(3,3,5,5-tetramethylcyclohexyl)phthalazin-1-amine.
| Compound Name | N-(3,3,5,5-tetramethylcyclohexyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 103967080 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-(3,3,5,5-tetramethylcyclohexyl)phthalazin-1-amine |
| SMILES | CC1(C)CC(Nc2nncc3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C18H25N3/c1-17(2)9-14(10-18(3,4)12-17)20-16-15-8-6-5-7-13(15)11-19-21-16/h5-8,11,14H,9-10,12H2,1-4H3,(H,20,21) |
| InChIKey | SCGMADSFBFSVKK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |