C19H26N2 — CID 103967142
N-(3,3,5,5-tetramethylcyclohexyl)quinolin-2-amine (PubChem CID 103967142) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(3,3,5,5-tetramethylcyclohexyl)quinolin-2-amine.
| Compound Name | N-(3,3,5,5-tetramethylcyclohexyl)quinolin-2-amine |
|---|---|
| PubChem CID | 103967142 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-(3,3,5,5-tetramethylcyclohexyl)quinolin-2-amine |
| SMILES | CC1(C)CC(Nc2ccc3ccccc3n2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H26N2/c1-18(2)11-15(12-19(3,4)13-18)20-17-10-9-14-7-5-6-8-16(14)21-17/h5-10,15H,11-13H2,1-4H3,(H,20,21) |
| InChIKey | ZILFUFBVRBGPCE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |