C17H29N3O — CID 103967207
1-propyl-3-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrazin-2-one (PubChem CID 103967207) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-propyl-3-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrazin-2-one.
| Compound Name | 1-propyl-3-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrazin-2-one |
|---|---|
| PubChem CID | 103967207 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-propyl-3-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrazin-2-one |
| SMILES | CCCn1ccnc(NC2CC(C)(C)CC(C)(C)C2)c1=O |
| InChI | InChI=1S/C17H29N3O/c1-6-8-20-9-7-18-14(15(20)21)19-13-10-16(2,3)12-17(4,5)11-13/h7,9,13H,6,8,10-12H2,1-5H3,(H,18,19) |
| InChIKey | NJTOYHFAPYJUEW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |