C14H22ClN3 — CID 103968163
3-chloro-N-(3,3,5,5-tetramethylcyclohexyl)pyrazin-2-amine (PubChem CID 103968163) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-chloro-N-(3,3,5,5-tetramethylcyclohexyl)pyrazin-2-amine.
| Compound Name | 3-chloro-N-(3,3,5,5-tetramethylcyclohexyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103968163 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-chloro-N-(3,3,5,5-tetramethylcyclohexyl)pyrazin-2-amine |
| SMILES | CC1(C)CC(Nc2nccnc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C14H22ClN3/c1-13(2)7-10(8-14(3,4)9-13)18-12-11(15)16-5-6-17-12/h5-6,10H,7-9H2,1-4H3,(H,17,18) |
| InChIKey | MQQVOKFWHQZANU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |