C16H25N3S — CID 103966872
2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyridine-3-carbothioamide (PubChem CID 103966872) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyridine-3-carbothioamide.
| Compound Name | 2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 103966872 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyridine-3-carbothioamide |
| SMILES | CC1(C)CC(Nc2ncccc2C(N)=S)CC(C)(C)C1 |
| InChI | InChI=1S/C16H25N3S/c1-15(2)8-11(9-16(3,4)10-15)19-14-12(13(17)20)6-5-7-18-14/h5-7,11H,8-10H2,1-4H3,(H2,17,20)(H,18,19) |
| InChIKey | YAPFYGGEHPIJNH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|