C16H26N4S — CID 107547944
6-methyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrimidine-4-carbothioamide (PubChem CID 107547944) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 6-methyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547944 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 6-methyl-2-[(3,3,5,5-tetramethylcyclohexyl)amino]pyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(NC2CC(C)(C)CC(C)(C)C2)n1 |
| InChI | InChI=1S/C16H26N4S/c1-10-6-12(13(17)21)20-14(18-10)19-11-7-15(2,3)9-16(4,5)8-11/h6,11H,7-9H2,1-5H3,(H2,17,21)(H,18,19,20) |
| InChIKey | HOHFLLTYGQBUSE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|