C14H25N3 — CID 106582100
1-butyl-N-(3,3-dimethylcyclopentyl)imidazol-2-amine (PubChem CID 106582100) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-butyl-N-(3,3-dimethylcyclopentyl)imidazol-2-amine.
| Compound Name | 1-butyl-N-(3,3-dimethylcyclopentyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106582100 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-butyl-N-(3,3-dimethylcyclopentyl)imidazol-2-amine |
| SMILES | CCCCn1ccnc1NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C14H25N3/c1-4-5-9-17-10-8-15-13(17)16-12-6-7-14(2,3)11-12/h8,10,12H,4-7,9,11H2,1-3H3,(H,15,16) |
| InChIKey | KLSKYEGJTAWTRA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |