C15H18Cl2N2S — CID 103967556
N-(2,5-dichlorophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 103967556) has the molecular formula C15H18Cl2N2S and a molecular weight of 329.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | N-(2,5-dichlorophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 103967556 |
| Molecular Formula | C15H18Cl2N2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | Clc1ccc(Cl)c(NC2=NCC3(CCCCC3)CS2)c1 |
| InChI | InChI=1S/C15H18Cl2N2S/c16-11-4-5-12(17)13(8-11)19-14-18-9-15(10-20-14)6-2-1-3-7-15/h4-5,8H,1-3,6-7,9-10H2,(H,18,19) |
| InChIKey | DPHSUPJCFRBANM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |