C14H15F3N2S — CID 115361736
N-(2,4,6-trifluorophenyl)-7-thia-9-azaspiro[4.5]dec-8-en-8-amine (PubChem CID 115361736) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(2,4,6-trifluorophenyl)-7-thia-9-azaspiro[4.5]dec-8-en-8-amine.
| Compound Name | N-(2,4,6-trifluorophenyl)-7-thia-9-azaspiro[4.5]dec-8-en-8-amine |
|---|---|
| PubChem CID | 115361736 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(2,4,6-trifluorophenyl)-7-thia-9-azaspiro[4.5]dec-8-en-8-amine |
| SMILES | Fc1cc(F)c(NC2=NCC3(CCCC3)CS2)c(F)c1 |
| InChI | InChI=1S/C14H15F3N2S/c15-9-5-10(16)12(11(17)6-9)19-13-18-7-14(8-20-13)3-1-2-4-14/h5-6H,1-4,7-8H2,(H,18,19) |
| InChIKey | DMOWTIGIKRLCDE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |