C13H21F3N2S — CID 103968009
N-(4,4,4-trifluorobutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine (PubChem CID 103968009) has the molecular formula C13H21F3N2S and a molecular weight of 294.39 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine.
| Compound Name | N-(4,4,4-trifluorobutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
|---|---|
| PubChem CID | 103968009 |
| Molecular Formula | C13H21F3N2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)-2-thia-4-azaspiro[5.5]undec-3-en-3-amine |
| SMILES | FC(F)(F)CCCNC1=NCC2(CCCCC2)CS1 |
| InChI | InChI=1S/C13H21F3N2S/c14-13(15,16)7-4-8-17-11-18-9-12(10-19-11)5-2-1-3-6-12/h1-10H2,(H,17,18) |
| InChIKey | XVAHFJYZSMMWQD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|