C15H25N3O2S — CID 103968306
2-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-4-sulfonamide (PubChem CID 103968306) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-4-sulfonamide.
| Compound Name | 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 103968306 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)pyridine-4-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2ccnc(N)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H25N3O2S/c1-14(2)8-11(9-15(3,4)10-14)18-21(19,20)12-5-6-17-13(16)7-12/h5-7,11,18H,8-10H2,1-4H3,(H2,16,17) |
| InChIKey | GTGABRPTDQLDLL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |