C8H14O3S — CID 103971203
(1Z)-1-(1,1-dioxothian-3-ylidene)propan-2-ol (PubChem CID 103971203) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is (1Z)-1-(1,1-dioxothian-3-ylidene)propan-2-ol.
| Compound Name | (1Z)-1-(1,1-dioxothian-3-ylidene)propan-2-ol |
|---|---|
| PubChem CID | 103971203 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (1Z)-1-(1,1-dioxothian-3-ylidene)propan-2-ol |
| SMILES | CC(O)/C=C1/CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O3S/c1-7(9)5-8-3-2-4-12(10,11)6-8/h5,7,9H,2-4,6H2,1H3/b8-5- |
| InChIKey | XZYKJZIGVOILQN-YVMONPNESA-N |
| XLogP | 0.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|