C9H19NS — CID 10397261
3-but-3-enylsulfanyl-N,N-dimethylpropan-1-amine (PubChem CID 10397261) has the molecular formula C9H19NS and a molecular weight of 173.32 g/mol. Its IUPAC name is 3-but-3-enylsulfanyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-but-3-enylsulfanyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 10397261 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-but-3-enylsulfanyl-N,N-dimethylpropan-1-amine |
| SMILES | C=CCCSCCCN(C)C |
| InChI | InChI=1S/C9H19NS/c1-4-5-8-11-9-6-7-10(2)3/h4H,1,5-9H2,2-3H3 |
| InChIKey | OUXJTPLLZUOGDV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|