C11H18F2O4 — CID 103973933
2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid (PubChem CID 103973933) has the molecular formula C11H18F2O4 and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid.
| Compound Name | 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103973933 |
| Molecular Formula | C11H18F2O4 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(CC(C)C)(CC(F)F)C(=O)O |
| InChI | InChI=1S/C11H18F2O4/c1-4-17-10(16)11(9(14)15,5-7(2)3)6-8(12)13/h7-8H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | ZVUQGSCCLTYTAV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|