2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid

C11H18F2O4 — CID 103973933

IUPAC2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid
SMILESCCOC(=O)C(CC(C)C)(CC(F)F)C(=O)O
InChIInChI=1S/C11H18F2O4/c1-4-17-10(16)11(9(14)15,5-7(2)3)6-8(12)13/h7-8H,4-6H2,1-3H3,(H,14,15)
InChIKeyZVUQGSCCLTYTAV-UHFFFAOYSA-N
MW252.26 g/mol
LogP2.32
Rot. Bonds7

About 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid

2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid (PubChem CID 103973933) has the molecular formula C11H18F2O4 and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid.

Molecular Properties

Compound Name2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid
PubChem CID103973933
Molecular FormulaC11H18F2O4
Molecular Weight252.26 g/mol
Exact Mass252.12
IUPAC Name2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid
SMILESCCOC(=O)C(CC(C)C)(CC(F)F)C(=O)O
InChIInChI=1S/C11H18F2O4/c1-4-17-10(16)11(9(14)15,5-7(2)3)6-8(12)13/h7-8H,4-6H2,1-3H3,(H,14,15)
InChIKeyZVUQGSCCLTYTAV-UHFFFAOYSA-N
XLogP2.32
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.26
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid?
The IUPAC name of 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid (CID 103973933) is 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid.
What is the SMILES notation for 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid?
The canonical SMILES for 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid is CCOC(=O)C(CC(C)C)(CC(F)F)C(=O)O.
What is the InChIKey of 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid?
The InChIKey is ZVUQGSCCLTYTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2O4/c1-4-17-10(16)11(9(14)15,5-7(2)3)6-8(12)13/h7-8H,4-6H2,1-3H3,(H,14,15).
What are the key properties of 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid?
2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid has a molecular weight of 252.26 g/mol, XLogP of 2.32, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-2-ethoxycarbonyl-4-methylpentanoic acid is sourced from PubChem (CID 103973933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).