C11H11Cl2N3O — CID 103977579
5,6-dichloro-2-(3-methyloxolan-2-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 103977579) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 5,6-dichloro-2-(3-methyloxolan-2-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-(3-methyloxolan-2-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 103977579 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5,6-dichloro-2-(3-methyloxolan-2-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CC1CCOC1c1nc2nc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C11H11Cl2N3O/c1-5-2-3-17-8(5)11-14-7-4-6(12)9(13)15-10(7)16-11/h4-5,8H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | YTQGPYGFGJOTIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|