C14H18O2 — CID 10398485
5-(3-phenylmethoxypropyl)-2,3-dihydrofuran (PubChem CID 10398485) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(3-phenylmethoxypropyl)-2,3-dihydrofuran.
| Compound Name | 5-(3-phenylmethoxypropyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 10398485 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-(3-phenylmethoxypropyl)-2,3-dihydrofuran |
| SMILES | C1=C(CCCOCc2ccccc2)OCC1 |
| InChI | InChI=1S/C14H18O2/c1-2-6-13(7-3-1)12-15-10-4-8-14-9-5-11-16-14/h1-3,6-7,9H,4-5,8,10-12H2 |
| InChIKey | OWRLHFYBSMQNJG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|