C10H13NO3S — CID 103985943
methyl 2-(oxolan-3-ylmethyl)-1,3-thiazole-4-carboxylate (PubChem CID 103985943) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is methyl 2-(oxolan-3-ylmethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(oxolan-3-ylmethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103985943 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl 2-(oxolan-3-ylmethyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(CC2CCOC2)n1 |
| InChI | InChI=1S/C10H13NO3S/c1-13-10(12)8-6-15-9(11-8)4-7-2-3-14-5-7/h6-7H,2-5H2,1H3 |
| InChIKey | DTZOETQCBGOKQT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |