C8H13N3O2 — CID 103988254
[3-(oxolan-3-ylmethyl)-1H-1,2,4-triazol-5-yl]methanol (PubChem CID 103988254) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is [3-(oxolan-3-ylmethyl)-1H-1,2,4-triazol-5-yl]methanol.
| Compound Name | [3-(oxolan-3-ylmethyl)-1H-1,2,4-triazol-5-yl]methanol |
|---|---|
| PubChem CID | 103988254 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | [3-(oxolan-3-ylmethyl)-1H-1,2,4-triazol-5-yl]methanol |
| SMILES | OCc1nc(CC2CCOC2)n[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c12-4-8-9-7(10-11-8)3-6-1-2-13-5-6/h6,12H,1-5H2,(H,9,10,11) |
| InChIKey | KPEFNYAADAYEQY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |