C11H16O5 — CID 10398870
(2R)-2-[(2S,5R)-5-(3-methoxy-3-oxoprop-1-en-2-yl)oxolan-2-yl]propanoic acid (PubChem CID 10398870) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (2R)-2-[(2S,5R)-5-(3-methoxy-3-oxoprop-1-en-2-yl)oxolan-2-yl]propanoic acid.
| Compound Name | (2R)-2-[(2S,5R)-5-(3-methoxy-3-oxoprop-1-en-2-yl)oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 10398870 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2R)-2-[(2S,5R)-5-(3-methoxy-3-oxoprop-1-en-2-yl)oxolan-2-yl]propanoic acid |
| SMILES | C=C(C(=O)OC)[C@H]1CC[C@@H]([C@@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C11H16O5/c1-6(10(12)13)8-4-5-9(16-8)7(2)11(14)15-3/h6,8-9H,2,4-5H2,1,3H3,(H,12,13)/t6-,8+,9-/m1/s1 |
| InChIKey | XFNVSLWBVWKXSY-BWVDBABLSA-N |
| XLogP | 0.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|