C7H13NO3 — CID 11500041
(2S,5R)-5-[(1R)-1-aminoethyl]oxolane-2-carboxylic acid (PubChem CID 11500041) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is (2S,5R)-5-[(1R)-1-aminoethyl]oxolane-2-carboxylic acid.
| Compound Name | (2S,5R)-5-[(1R)-1-aminoethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 11500041 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2S,5R)-5-[(1R)-1-aminoethyl]oxolane-2-carboxylic acid |
| SMILES | C[C@@H](N)[C@H]1CC[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C7H13NO3/c1-4(8)5-2-3-6(11-5)7(9)10/h4-6H,2-3,8H2,1H3,(H,9,10)/t4-,5-,6+/m1/s1 |
| InChIKey | AQUMMLVSQTVCGS-PBXRRBTRSA-N |
| XLogP | -0.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |