C7H16N2O2 — CID 163085908
(2S,3S,6S)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-ol (PubChem CID 163085908) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2S,3S,6S)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-ol.
| Compound Name | (2S,3S,6S)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-ol |
|---|---|
| PubChem CID | 163085908 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | (2S,3S,6S)-3-amino-6-[(1S)-1-aminoethyl]oxan-2-ol |
| SMILES | C[C@H](N)[C@@H]1CC[C@H](N)[C@@H](O)O1 |
| InChI | InChI=1S/C7H16N2O2/c1-4(8)6-3-2-5(9)7(10)11-6/h4-7,10H,2-3,8-9H2,1H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | LZZVSXDBIJCPBJ-AXMZGBSTSA-N |
| XLogP | -0.84 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |