C7H5BrN2S — CID 10398915
5-bromo-1,2-benzothiazol-3-amine (PubChem CID 10398915) has the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. Its IUPAC name is 5-bromo-1,2-benzothiazol-3-amine.
| Compound Name | 5-bromo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 10398915 |
| Molecular Formula | C7H5BrN2S |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | 5-bromo-1,2-benzothiazol-3-amine |
| SMILES | Nc1nsc2ccc(Br)cc12 |
| InChI | InChI=1S/C7H5BrN2S/c8-4-1-2-6-5(3-4)7(9)10-11-6/h1-3H,(H2,9,10) |
| InChIKey | NTLSBZHEUNMUAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |