About N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine
N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 103989880) has the molecular formula C15H21N3S
and a molecular weight of 275.42 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine |
| PubChem CID | 103989880 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | CN1CCC(C)(CNc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C15H21N3S/c1-15(7-9-18(2)10-8-15)11-16-14-17-12-5-3-4-6-13(12)19-14/h3-6H,7-11H2,1-2H3,(H,16,17) |
| InChIKey | UCWFQFJSTGXHBP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine?
The IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine (CID 103989880) is N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine is CN1CCC(C)(CNc2nc3ccccc3s2)CC1.
What is the InChIKey of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine?
The InChIKey is UCWFQFJSTGXHBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3S/c1-15(7-9-18(2)10-8-15)11-16-14-17-12-5-3-4-6-13(12)19-14/h3-6H,7-11H2,1-2H3,(H,16,17).
What are the key properties of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine?
N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine has a molecular weight of 275.42 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 103989880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).