C12H18N4O2S — CID 103990351
1-(1-ethylimidazol-4-yl)sulfonyl-4-methylpiperidine-4-carbonitrile (PubChem CID 103990351) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-(1-ethylimidazol-4-yl)sulfonyl-4-methylpiperidine-4-carbonitrile.
| Compound Name | 1-(1-ethylimidazol-4-yl)sulfonyl-4-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 103990351 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(1-ethylimidazol-4-yl)sulfonyl-4-methylpiperidine-4-carbonitrile |
| SMILES | CCn1cnc(S(=O)(=O)N2CCC(C)(C#N)CC2)c1 |
| InChI | InChI=1S/C12H18N4O2S/c1-3-15-8-11(14-10-15)19(17,18)16-6-4-12(2,9-13)5-7-16/h8,10H,3-7H2,1-2H3 |
| InChIKey | QNYQJHIHMGYYPC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |