C12H18N2O — CID 103991879
N-[(1-methoxycyclobutyl)methyl]-1-pyridin-4-ylmethanamine (PubChem CID 103991879) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[(1-methoxycyclobutyl)methyl]-1-pyridin-4-ylmethanamine.
| Compound Name | N-[(1-methoxycyclobutyl)methyl]-1-pyridin-4-ylmethanamine |
|---|---|
| PubChem CID | 103991879 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-[(1-methoxycyclobutyl)methyl]-1-pyridin-4-ylmethanamine |
| SMILES | COC1(CNCc2ccncc2)CCC1 |
| InChI | InChI=1S/C12H18N2O/c1-15-12(5-2-6-12)10-14-9-11-3-7-13-8-4-11/h3-4,7-8,14H,2,5-6,9-10H2,1H3 |
| InChIKey | MQSNQOVFHMRCIY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |