C13H19NO2 — CID 102809731
4-[[(1-methoxycyclobutyl)methylamino]methyl]phenol (PubChem CID 102809731) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-[[(1-methoxycyclobutyl)methylamino]methyl]phenol.
| Compound Name | 4-[[(1-methoxycyclobutyl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 102809731 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-[[(1-methoxycyclobutyl)methylamino]methyl]phenol |
| SMILES | COC1(CNCc2ccc(O)cc2)CCC1 |
| InChI | InChI=1S/C13H19NO2/c1-16-13(7-2-8-13)10-14-9-11-3-5-12(15)6-4-11/h3-6,14-15H,2,7-10H2,1H3 |
| InChIKey | FCZULHKYXFDKND-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |