C13H20N2O — CID 104756789
N-[(1-methoxycyclobutyl)methyl]-1-(6-methyl-3-pyridinyl)methanamine (PubChem CID 104756789) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-[(1-methoxycyclobutyl)methyl]-1-(6-methyl-3-pyridinyl)methanamine.
| Compound Name | N-[(1-methoxycyclobutyl)methyl]-1-(6-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 104756789 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-[(1-methoxycyclobutyl)methyl]-1-(6-methyl-3-pyridinyl)methanamine |
| SMILES | COC1(CNCc2ccc(C)nc2)CCC1 |
| InChI | InChI=1S/C13H20N2O/c1-11-4-5-12(9-15-11)8-14-10-13(16-2)6-3-7-13/h4-5,9,14H,3,6-8,10H2,1-2H3 |
| InChIKey | OIRFUUMWKGUMJK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |