C13H20N2 — CID 103993975
1-cyclohex-2-en-1-yl-4-methylpiperidine-4-carbonitrile (PubChem CID 103993975) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-4-methylpiperidine-4-carbonitrile.
| Compound Name | 1-cyclohex-2-en-1-yl-4-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 103993975 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-4-methylpiperidine-4-carbonitrile |
| SMILES | CC1(C#N)CCN(C2C=CCCC2)CC1 |
| InChI | InChI=1S/C13H20N2/c1-13(11-14)7-9-15(10-8-13)12-5-3-2-4-6-12/h3,5,12H,2,4,6-10H2,1H3 |
| InChIKey | MVSGAXGJWDRRST-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|